C20H23NO3 — CID 134839697
tert-butyl N-[2-[(Z)-2-[2-(hydroxymethyl)phenyl]ethenyl]phenyl]carbamate (PubChem CID 134839697) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is tert-butyl N-[2-[(Z)-2-[2-(hydroxymethyl)phenyl]ethenyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[(Z)-2-[2-(hydroxymethyl)phenyl]ethenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 134839697 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | tert-butyl N-[2-[(Z)-2-[2-(hydroxymethyl)phenyl]ethenyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1/C=C\c1ccccc1CO |
| InChI | InChI=1S/C20H23NO3/c1-20(2,3)24-19(23)21-18-11-7-6-9-16(18)13-12-15-8-4-5-10-17(15)14-22/h4-13,22H,14H2,1-3H3,(H,21,23)/b13-12- |
| InChIKey | PEWGFKLBJMFURJ-SEYXRHQNSA-N |
| XLogP | 4.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|