C20H23NO2 — CID 154704341
tert-butyl N-[2-[(E)-2-(4-methylphenyl)ethenyl]phenyl]carbamate (PubChem CID 154704341) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl N-[2-[(E)-2-(4-methylphenyl)ethenyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[(E)-2-(4-methylphenyl)ethenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 154704341 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | tert-butyl N-[2-[(E)-2-(4-methylphenyl)ethenyl]phenyl]carbamate |
| SMILES | Cc1ccc(/C=C/c2ccccc2NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H23NO2/c1-15-9-11-16(12-10-15)13-14-17-7-5-6-8-18(17)21-19(22)23-20(2,3)4/h5-14H,1-4H3,(H,21,22)/b14-13+ |
| InChIKey | HUSWPICOSQEEHZ-BUHFOSPRSA-N |
| XLogP | 5.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|