C23H28N2O5 — CID 142884369
tert-butyl N-(2-formamidophenyl)carbamate;methyl (E)-3-(4-methylphenyl)prop-2-enoate (PubChem CID 142884369) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is tert-butyl N-(2-formamidophenyl)carbamate;methyl (E)-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | tert-butyl N-(2-formamidophenyl)carbamate;methyl (E)-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 142884369 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | tert-butyl N-(2-formamidophenyl)carbamate;methyl (E)-3-(4-methylphenyl)prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1NC=O.COC(=O)/C=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C12H16N2O3.C11H12O2/c1-12(2,3)17-11(16)14-10-7-5-4-6-9(10)13-8-15;1-9-3-5-10(6-4-9)7-8-11(12)13-2/h4-8H,1-3H3,(H,13,15)(H,14,16);3-8H,1-2H3/b;8-7+ |
| InChIKey | PHYXSJSYPBGWJI-ILHSMLOTSA-N |
| XLogP | 4.78 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|