C24H24N2O3 — CID 159441655
tert-butyl N-[2-[2-oxo-2-(4-pyridin-4-ylphenyl)ethyl]phenyl]carbamate (PubChem CID 159441655) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is tert-butyl N-[2-[2-oxo-2-(4-pyridin-4-ylphenyl)ethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-oxo-2-(4-pyridin-4-ylphenyl)ethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 159441655 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | tert-butyl N-[2-[2-oxo-2-(4-pyridin-4-ylphenyl)ethyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1CC(=O)c1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/C24H24N2O3/c1-24(2,3)29-23(28)26-21-7-5-4-6-20(21)16-22(27)19-10-8-17(9-11-19)18-12-14-25-15-13-18/h4-15H,16H2,1-3H3,(H,26,28) |
| InChIKey | VQNQPCIQIRTGEF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |