C18H21NO4S — CID 58208093
tert-butyl N-[4-[2-[4-(hydroxymethyl)phenyl]-2-oxoethyl]thiophen-3-yl]carbamate (PubChem CID 58208093) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[4-(hydroxymethyl)phenyl]-2-oxoethyl]thiophen-3-yl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[4-(hydroxymethyl)phenyl]-2-oxoethyl]thiophen-3-yl]carbamate |
|---|---|
| PubChem CID | 58208093 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | tert-butyl N-[4-[2-[4-(hydroxymethyl)phenyl]-2-oxoethyl]thiophen-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cscc1CC(=O)c1ccc(CO)cc1 |
| InChI | InChI=1S/C18H21NO4S/c1-18(2,3)23-17(22)19-15-11-24-10-14(15)8-16(21)13-6-4-12(9-20)5-7-13/h4-7,10-11,20H,8-9H2,1-3H3,(H,19,22) |
| InChIKey | HCEXMQVPKIPMEV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |