C25H36N4O4S — CID 58208295
tert-butyl N-[4-[2-[5-[(4-morpholin-4-ylbutylamino)methyl]-2-pyridinyl]-2-oxoethyl]thiophen-3-yl]carbamate (PubChem CID 58208295) has the molecular formula C25H36N4O4S and a molecular weight of 488.65 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[5-[(4-morpholin-4-ylbutylamino)methyl]-2-pyridinyl]-2-oxoethyl]thiophen-3-yl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[5-[(4-morpholin-4-ylbutylamino)methyl]-2-pyridinyl]-2-oxoethyl]thiophen-3-yl]carbamate |
|---|---|
| PubChem CID | 58208295 |
| Molecular Formula | C25H36N4O4S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | tert-butyl N-[4-[2-[5-[(4-morpholin-4-ylbutylamino)methyl]-2-pyridinyl]-2-oxoethyl]thiophen-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cscc1CC(=O)c1ccc(CNCCCCN2CCOCC2)cn1 |
| InChI | InChI=1S/C25H36N4O4S/c1-25(2,3)33-24(31)28-22-18-34-17-20(22)14-23(30)21-7-6-19(16-27-21)15-26-8-4-5-9-29-10-12-32-13-11-29/h6-7,16-18,26H,4-5,8-15H2,1-3H3,(H,28,31) |
| InChIKey | MMQOPCKSBONWSF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|