C28H42N6O5S — CID 67054141
tert-butyl N-[4-[[5-[5-morpholin-4-yl-1-(propylcarbamoylamino)pentyl]pyridine-2-carbonyl]amino]thiophen-3-yl]carbamate (PubChem CID 67054141) has the molecular formula C28H42N6O5S and a molecular weight of 574.75 g/mol. Its IUPAC name is tert-butyl N-[4-[[5-[5-morpholin-4-yl-1-(propylcarbamoylamino)pentyl]pyridine-2-carbonyl]amino]thiophen-3-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[5-[5-morpholin-4-yl-1-(propylcarbamoylamino)pentyl]pyridine-2-carbonyl]amino]thiophen-3-yl]carbamate |
|---|---|
| PubChem CID | 67054141 |
| Molecular Formula | C28H42N6O5S |
| Molecular Weight | 574.75 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | tert-butyl N-[4-[[5-[5-morpholin-4-yl-1-(propylcarbamoylamino)pentyl]pyridine-2-carbonyl]amino]thiophen-3-yl]carbamate |
| SMILES | CCCNC(=O)NC(CCCCN1CCOCC1)c1ccc(C(=O)Nc2cscc2NC(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C28H42N6O5S/c1-5-11-29-26(36)32-21(8-6-7-12-34-13-15-38-16-14-34)20-9-10-22(30-17-20)25(35)31-23-18-40-19-24(23)33-27(37)39-28(2,3)4/h9-10,17-19,21H,5-8,11-16H2,1-4H3,(H,31,35)(H,33,37)(H2,29,32,36) |
| InChIKey | GIVJAZQOPRZCCG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 133.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.75 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|