C30H39N7O5S — CID 87638720
tert-butyl N-[2-[[5-[5-morpholin-4-yl-1-(1,3-thiazol-2-ylcarbamoylamino)pentyl]pyridine-2-carbonyl]amino]phenyl]carbamate (PubChem CID 87638720) has the molecular formula C30H39N7O5S and a molecular weight of 609.75 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-[5-morpholin-4-yl-1-(1,3-thiazol-2-ylcarbamoylamino)pentyl]pyridine-2-carbonyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-[5-morpholin-4-yl-1-(1,3-thiazol-2-ylcarbamoylamino)pentyl]pyridine-2-carbonyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 87638720 |
| Molecular Formula | C30H39N7O5S |
| Molecular Weight | 609.75 g/mol |
| Exact Mass | 609.27 |
| IUPAC Name | tert-butyl N-[2-[[5-[5-morpholin-4-yl-1-(1,3-thiazol-2-ylcarbamoylamino)pentyl]pyridine-2-carbonyl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1NC(=O)c1ccc(C(CCCCN2CCOCC2)NC(=O)Nc2nccs2)cn1 |
| InChI | InChI=1S/C30H39N7O5S/c1-30(2,3)42-29(40)35-24-10-5-4-9-23(24)33-26(38)25-12-11-21(20-32-25)22(34-27(39)36-28-31-13-19-43-28)8-6-7-14-37-15-17-41-18-16-37/h4-5,9-13,19-20,22H,6-8,14-18H2,1-3H3,(H,33,38)(H,35,40)(H2,31,34,36,39) |
| InChIKey | ZOUJSTCGPTXPPT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 146.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.75 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|