C32H42F2N6O5S — CID 143897005
tert-butyl N-[4-[[5-[[[(2E,4E,6E)-2,7-difluoroocta-2,4,6-trien-4-yl]carbamoyl-(3-morpholin-4-ylpropyl)amino]methyl]pyridine-2-carbonyl]amino]thiophen-3-yl]carbamate (PubChem CID 143897005) has the molecular formula C32H42F2N6O5S and a molecular weight of 660.79 g/mol. Its IUPAC name is tert-butyl N-[4-[[5-[[[(2E,4E,6E)-2,7-difluoroocta-2,4,6-trien-4-yl]carbamoyl-(3-morpholin-4-ylpropyl)amino]methyl]pyridine-2-carbonyl]amino]thiophen-3-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[5-[[[(2E,4E,6E)-2,7-difluoroocta-2,4,6-trien-4-yl]carbamoyl-(3-morpholin-4-ylpropyl)amino]methyl]pyridine-2-carbonyl]amino]thiophen-3-yl]carbamate |
|---|---|
| PubChem CID | 143897005 |
| Molecular Formula | C32H42F2N6O5S |
| Molecular Weight | 660.79 g/mol |
| Exact Mass | 660.29 |
| IUPAC Name | tert-butyl N-[4-[[5-[[[(2E,4E,6E)-2,7-difluoroocta-2,4,6-trien-4-yl]carbamoyl-(3-morpholin-4-ylpropyl)amino]methyl]pyridine-2-carbonyl]amino]thiophen-3-yl]carbamate |
| SMILES | C/C(F)=C\C=C(/C=C(\C)F)NC(=O)N(CCCN1CCOCC1)Cc1ccc(C(=O)Nc2cscc2NC(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C32H42F2N6O5S/c1-22(33)7-9-25(17-23(2)34)36-30(42)40(12-6-11-39-13-15-44-16-14-39)19-24-8-10-26(35-18-24)29(41)37-27-20-46-21-28(27)38-31(43)45-32(3,4)5/h7-10,17-18,20-21H,6,11-16,19H2,1-5H3,(H,36,42)(H,37,41)(H,38,43)/b22-7+,23-17+,25-9+ |
| InChIKey | XBGHCYJEBNCIBN-ZFFPFHGASA-N |
| XLogP | 6.61 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.79 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|