C22H24N2O6 — CID 46224124
2-[2-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propanoylamino]phenyl]-2-oxoacetic acid (PubChem CID 46224124) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is 2-[2-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propanoylamino]phenyl]-2-oxoacetic acid.
| Compound Name | 2-[2-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propanoylamino]phenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 46224124 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-[2-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propanoylamino]phenyl]-2-oxoacetic acid |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1CCC(=O)Nc1ccccc1C(=O)C(=O)O |
| InChI | InChI=1S/C22H24N2O6/c1-22(2,3)30-21(29)24-16-10-6-4-8-14(16)12-13-18(25)23-17-11-7-5-9-15(17)19(26)20(27)28/h4-11H,12-13H2,1-3H3,(H,23,25)(H,24,29)(H,27,28) |
| InChIKey | BLCXGGQFGOZUJM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|