C21H28N4O3 — CID 100737817
tert-butyl N-[2-[3-[[5-(dimethylamino)-2-pyridinyl]amino]-3-oxopropyl]phenyl]carbamate (PubChem CID 100737817) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[[5-(dimethylamino)-2-pyridinyl]amino]-3-oxopropyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[[5-(dimethylamino)-2-pyridinyl]amino]-3-oxopropyl]phenyl]carbamate |
|---|---|
| PubChem CID | 100737817 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | tert-butyl N-[2-[3-[[5-(dimethylamino)-2-pyridinyl]amino]-3-oxopropyl]phenyl]carbamate |
| SMILES | CN(C)c1ccc(NC(=O)CCc2ccccc2NC(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C21H28N4O3/c1-21(2,3)28-20(27)23-17-9-7-6-8-15(17)10-13-19(26)24-18-12-11-16(14-22-18)25(4)5/h6-9,11-12,14H,10,13H2,1-5H3,(H,23,27)(H,22,24,26) |
| InChIKey | PZWMWJHUZOUSBL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |