C16H17N3O3 — CID 39187725
4-[[5-(N-methylanilino)-2-pyridinyl]amino]-4-oxobutanoic acid (PubChem CID 39187725) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 4-[[5-(N-methylanilino)-2-pyridinyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[5-(N-methylanilino)-2-pyridinyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 39187725 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 4-[[5-(N-methylanilino)-2-pyridinyl]amino]-4-oxobutanoic acid |
| SMILES | CN(c1ccccc1)c1ccc(NC(=O)CCC(=O)O)nc1 |
| InChI | InChI=1S/C16H17N3O3/c1-19(12-5-3-2-4-6-12)13-7-8-14(17-11-13)18-15(20)9-10-16(21)22/h2-8,11H,9-10H2,1H3,(H,21,22)(H,17,18,20) |
| InChIKey | NQCIYNVUOGWUAT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |