C14H22N4O3 — CID 39187475
4-[[5-[3-(dimethylamino)propylamino]-2-pyridinyl]amino]-4-oxobutanoic acid (PubChem CID 39187475) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is 4-[[5-[3-(dimethylamino)propylamino]-2-pyridinyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[5-[3-(dimethylamino)propylamino]-2-pyridinyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 39187475 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 4-[[5-[3-(dimethylamino)propylamino]-2-pyridinyl]amino]-4-oxobutanoic acid |
| SMILES | CN(C)CCCNc1ccc(NC(=O)CCC(=O)O)nc1 |
| InChI | InChI=1S/C14H22N4O3/c1-18(2)9-3-8-15-11-4-5-12(16-10-11)17-13(19)6-7-14(20)21/h4-5,10,15H,3,6-9H2,1-2H3,(H,20,21)(H,16,17,19) |
| InChIKey | AXQCLPORTJEDBR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|