C18H23ClN4O — CID 113010953
2-(4-chlorophenyl)-N-[6-[3-(dimethylamino)propylamino]-3-pyridinyl]acetamide (PubChem CID 113010953) has the molecular formula C18H23ClN4O and a molecular weight of 346.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[6-[3-(dimethylamino)propylamino]-3-pyridinyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[6-[3-(dimethylamino)propylamino]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 113010953 |
| Molecular Formula | C18H23ClN4O |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[6-[3-(dimethylamino)propylamino]-3-pyridinyl]acetamide |
| SMILES | CN(C)CCCNc1ccc(NC(=O)Cc2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C18H23ClN4O/c1-23(2)11-3-10-20-17-9-8-16(13-21-17)22-18(24)12-14-4-6-15(19)7-5-14/h4-9,13H,3,10-12H2,1-2H3,(H,20,21)(H,22,24) |
| InChIKey | LBLGGSGZFXRGIZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|