C18H16Cl3N3O8S — CID 70634549
2,2,2-trichloroethyl (6R)-3-methylidene-7-[(4-nitrophenyl)methoxycarbonylamino]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 70634549) has the molecular formula C18H16Cl3N3O8S and a molecular weight of 540.77 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6R)-3-methylidene-7-[(4-nitrophenyl)methoxycarbonylamino]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6R)-3-methylidene-7-[(4-nitrophenyl)methoxycarbonylamino]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 70634549 |
| Molecular Formula | C18H16Cl3N3O8S |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 538.97 |
| IUPAC Name | 2,2,2-trichloroethyl (6R)-3-methylidene-7-[(4-nitrophenyl)methoxycarbonylamino]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | C=C1CS(=O)[C@@H]2C(NC(=O)OCc3ccc([N+](=O)[O-])cc3)C(=O)N2C1C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H16Cl3N3O8S/c1-9-7-33(30)15-12(14(25)23(15)13(9)16(26)32-8-18(19,20)21)22-17(27)31-6-10-2-4-11(5-3-10)24(28)29/h2-5,12-13,15H,1,6-8H2,(H,22,27)/t12?,13?,15-,33?/m1/s1 |
| InChIKey | YXNLHOIVZVJSJL-QGOYQSTNSA-N |
| XLogP | 1.96 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|