C23H19Cl2N3O7S — CID 22798026
(4-nitrophenyl)methyl (6S)-7-[[2-(2,5-dichlorophenyl)acetyl]amino]-3-methylidene-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 22798026) has the molecular formula C23H19Cl2N3O7S and a molecular weight of 552.39 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6S)-7-[[2-(2,5-dichlorophenyl)acetyl]amino]-3-methylidene-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6S)-7-[[2-(2,5-dichlorophenyl)acetyl]amino]-3-methylidene-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 22798026 |
| Molecular Formula | C23H19Cl2N3O7S |
| Molecular Weight | 552.39 g/mol |
| Exact Mass | 551.03 |
| IUPAC Name | (4-nitrophenyl)methyl (6S)-7-[[2-(2,5-dichlorophenyl)acetyl]amino]-3-methylidene-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | C=C1CS(=O)[C@H]2C(NC(=O)Cc3cc(Cl)ccc3Cl)C(=O)N2C1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H19Cl2N3O7S/c1-12-11-36(34)22-19(26-18(29)9-14-8-15(24)4-7-17(14)25)21(30)27(22)20(12)23(31)35-10-13-2-5-16(6-3-13)28(32)33/h2-8,19-20,22H,1,9-11H2,(H,26,29)/t19?,20?,22-,36?/m0/s1 |
| InChIKey | WSLPTLZOCJPDTO-UVLOLOSBSA-N |
| XLogP | 2.53 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|