C28H29Cl2N3O8S — CID 70623071
ethyl 3-[2-[3-[[2-(2,5-dichlorophenyl)acetyl]amino]-1-[2-[(4-nitrophenyl)methoxy]-2-oxoethyl]-4-oxoazetidin-2-yl]prop-1-enylsulfanyl]propanoate (PubChem CID 70623071) has the molecular formula C28H29Cl2N3O8S and a molecular weight of 638.53 g/mol. Its IUPAC name is ethyl 3-[2-[3-[[2-(2,5-dichlorophenyl)acetyl]amino]-1-[2-[(4-nitrophenyl)methoxy]-2-oxoethyl]-4-oxoazetidin-2-yl]prop-1-enylsulfanyl]propanoate.
| Compound Name | ethyl 3-[2-[3-[[2-(2,5-dichlorophenyl)acetyl]amino]-1-[2-[(4-nitrophenyl)methoxy]-2-oxoethyl]-4-oxoazetidin-2-yl]prop-1-enylsulfanyl]propanoate |
|---|---|
| PubChem CID | 70623071 |
| Molecular Formula | C28H29Cl2N3O8S |
| Molecular Weight | 638.53 g/mol |
| Exact Mass | 637.11 |
| IUPAC Name | ethyl 3-[2-[3-[[2-(2,5-dichlorophenyl)acetyl]amino]-1-[2-[(4-nitrophenyl)methoxy]-2-oxoethyl]-4-oxoazetidin-2-yl]prop-1-enylsulfanyl]propanoate |
| SMILES | CCOC(=O)CCSC=C(C)C1C(NC(=O)Cc2cc(Cl)ccc2Cl)C(=O)N1CC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H29Cl2N3O8S/c1-3-40-24(35)10-11-42-16-17(2)27-26(31-23(34)13-19-12-20(29)6-9-22(19)30)28(37)32(27)14-25(36)41-15-18-4-7-21(8-5-18)33(38)39/h4-9,12,16,26-27H,3,10-11,13-15H2,1-2H3,(H,31,34) |
| InChIKey | ABYJMFNZENOFAG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|