C26H24N4O10S — CID 22798034
(4-nitrophenyl)methyl (6S)-7-[[2-(4-nitrophenyl)acetyl]amino]-8-oxo-3-(propanoyloxymethyl)-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate (PubChem CID 22798034) has the molecular formula C26H24N4O10S and a molecular weight of 584.56 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6S)-7-[[2-(4-nitrophenyl)acetyl]amino]-8-oxo-3-(propanoyloxymethyl)-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6S)-7-[[2-(4-nitrophenyl)acetyl]amino]-8-oxo-3-(propanoyloxymethyl)-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
|---|---|
| PubChem CID | 22798034 |
| Molecular Formula | C26H24N4O10S |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | (4-nitrophenyl)methyl (6S)-7-[[2-(4-nitrophenyl)acetyl]amino]-8-oxo-3-(propanoyloxymethyl)-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
| SMILES | CCC(=O)OCC1=CS[C@H]2C(NC(=O)Cc3ccc([N+](=O)[O-])cc3)C(=O)N2C1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H24N4O10S/c1-2-21(32)39-13-17-14-41-25-22(27-20(31)11-15-3-7-18(8-4-15)29(35)36)24(33)28(25)23(17)26(34)40-12-16-5-9-19(10-6-16)30(37)38/h3-10,14,22-23,25H,2,11-13H2,1H3,(H,27,31)/t22?,23?,25-/m0/s1 |
| InChIKey | XZJQGVRWSGMIAV-RVMZIBIISA-N |
| XLogP | 2.39 |
| TPSA | 188.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|