C23H22BrN3O6S — CID 70406018
(4-nitrophenyl)methyl (6R)-3-bromo-3-methyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 70406018) has the molecular formula C23H22BrN3O6S and a molecular weight of 548.42 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-3-bromo-3-methyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-3-bromo-3-methyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 70406018 |
| Molecular Formula | C23H22BrN3O6S |
| Molecular Weight | 548.42 g/mol |
| Exact Mass | 547.04 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-3-bromo-3-methyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | CC1(Br)CS[C@@H]2C(NC(=O)Cc3ccccc3)C(=O)N2C1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H22BrN3O6S/c1-23(24)13-34-21-18(25-17(28)11-14-5-3-2-4-6-14)20(29)26(21)19(23)22(30)33-12-15-7-9-16(10-8-15)27(31)32/h2-10,18-19,21H,11-13H2,1H3,(H,25,28)/t18?,19?,21-,23?/m1/s1 |
| InChIKey | OOOVLFBQMUSKCV-LHLXLEJZSA-N |
| XLogP | 2.80 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|