C23H22N4O11S — CID 173427537
1-[2-methyl-4-[(4-nitrophenyl)methoxy]-4-oxobut-2-enyl]-3-[(4-nitrophenyl)methoxycarbonylamino]-4-oxoazetidine-2-sulfinic acid (PubChem CID 173427537) has the molecular formula C23H22N4O11S and a molecular weight of 562.51 g/mol. Its IUPAC name is 1-[2-methyl-4-[(4-nitrophenyl)methoxy]-4-oxobut-2-enyl]-3-[(4-nitrophenyl)methoxycarbonylamino]-4-oxoazetidine-2-sulfinic acid.
| Compound Name | 1-[2-methyl-4-[(4-nitrophenyl)methoxy]-4-oxobut-2-enyl]-3-[(4-nitrophenyl)methoxycarbonylamino]-4-oxoazetidine-2-sulfinic acid |
|---|---|
| PubChem CID | 173427537 |
| Molecular Formula | C23H22N4O11S |
| Molecular Weight | 562.51 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | 1-[2-methyl-4-[(4-nitrophenyl)methoxy]-4-oxobut-2-enyl]-3-[(4-nitrophenyl)methoxycarbonylamino]-4-oxoazetidine-2-sulfinic acid |
| SMILES | CC(=CC(=O)OCc1ccc([N+](=O)[O-])cc1)CN1C(=O)C(NC(=O)OCc2ccc([N+](=O)[O-])cc2)C1S(=O)O |
| InChI | InChI=1S/C23H22N4O11S/c1-14(10-19(28)37-12-15-2-6-17(7-3-15)26(31)32)11-25-21(29)20(22(25)39(35)36)24-23(30)38-13-16-4-8-18(9-5-16)27(33)34/h2-10,20,22H,11-13H2,1H3,(H,24,30)(H,35,36) |
| InChIKey | NZDCZKLVNVSIHC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 208.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|