C18H23N3O8 — CID 13489005
(4-nitrophenyl)methyl 2-[(2R,3S)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxoazetidin-1-yl]oxyacetate (PubChem CID 13489005) has the molecular formula C18H23N3O8 and a molecular weight of 409.40 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(2R,3S)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxoazetidin-1-yl]oxyacetate.
| Compound Name | (4-nitrophenyl)methyl 2-[(2R,3S)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxoazetidin-1-yl]oxyacetate |
|---|---|
| PubChem CID | 13489005 |
| Molecular Formula | C18H23N3O8 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(2R,3S)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxoazetidin-1-yl]oxyacetate |
| SMILES | C[C@@H]1[C@H](NC(=O)OC(C)(C)C)C(=O)N1OCC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H23N3O8/c1-11-15(19-17(24)29-18(2,3)4)16(23)20(11)28-10-14(22)27-9-12-5-7-13(8-6-12)21(25)26/h5-8,11,15H,9-10H2,1-4H3,(H,19,24)/t11-,15+/m1/s1 |
| InChIKey | ZPLUSKUIDQSICO-ABAIWWIYSA-N |
| XLogP | 1.69 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|