C23H25N3O9S — CID 15416782
(4-nitrophenyl)methyl 2-(benzenesulfonyl)-2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazetidin-1-yl]acetate (PubChem CID 15416782) has the molecular formula C23H25N3O9S and a molecular weight of 519.53 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-(benzenesulfonyl)-2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazetidin-1-yl]acetate.
| Compound Name | (4-nitrophenyl)methyl 2-(benzenesulfonyl)-2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazetidin-1-yl]acetate |
|---|---|
| PubChem CID | 15416782 |
| Molecular Formula | C23H25N3O9S |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | (4-nitrophenyl)methyl 2-(benzenesulfonyl)-2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazetidin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CN(C(C(=O)OCc2ccc([N+](=O)[O-])cc2)S(=O)(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C23H25N3O9S/c1-23(2,3)35-22(29)24-18-13-25(19(18)27)20(36(32,33)17-7-5-4-6-8-17)21(28)34-14-15-9-11-16(12-10-15)26(30)31/h4-12,18,20H,13-14H2,1-3H3,(H,24,29)/t18-,20?/m0/s1 |
| InChIKey | LWLRZVUQMIETJY-LROBGIAVSA-N |
| XLogP | 2.17 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|