C16H23N3O7S — CID 129047575
tert-butyl N-[(3R,5S)-5-(hydroxymethyl)-1-(4-nitrophenyl)sulfonylpyrrolidin-3-yl]carbamate (PubChem CID 129047575) has the molecular formula C16H23N3O7S and a molecular weight of 401.44 g/mol. Its IUPAC name is tert-butyl N-[(3R,5S)-5-(hydroxymethyl)-1-(4-nitrophenyl)sulfonylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,5S)-5-(hydroxymethyl)-1-(4-nitrophenyl)sulfonylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 129047575 |
| Molecular Formula | C16H23N3O7S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | tert-butyl N-[(3R,5S)-5-(hydroxymethyl)-1-(4-nitrophenyl)sulfonylpyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H](CO)N(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C16H23N3O7S/c1-16(2,3)26-15(21)17-11-8-13(10-20)18(9-11)27(24,25)14-6-4-12(5-7-14)19(22)23/h4-7,11,13,20H,8-10H2,1-3H3,(H,17,21)/t11-,13+/m1/s1 |
| InChIKey | QYZYMZBRDHYPLF-YPMHNXCESA-N |
| XLogP | 1.24 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|