C21H32N4O9S — CID 143367493
tert-butyl N-methylcarbamate;methyl 2-[[1-(4-nitrophenyl)sulfonylpiperidine-3-carbonyl]amino]acetate (PubChem CID 143367493) has the molecular formula C21H32N4O9S and a molecular weight of 516.57 g/mol. Its IUPAC name is tert-butyl N-methylcarbamate;methyl 2-[[1-(4-nitrophenyl)sulfonylpiperidine-3-carbonyl]amino]acetate.
| Compound Name | tert-butyl N-methylcarbamate;methyl 2-[[1-(4-nitrophenyl)sulfonylpiperidine-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 143367493 |
| Molecular Formula | C21H32N4O9S |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | tert-butyl N-methylcarbamate;methyl 2-[[1-(4-nitrophenyl)sulfonylpiperidine-3-carbonyl]amino]acetate |
| SMILES | CNC(=O)OC(C)(C)C.COC(=O)CNC(=O)C1CCCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C15H19N3O7S.C6H13NO2/c1-25-14(19)9-16-15(20)11-3-2-8-17(10-11)26(23,24)13-6-4-12(5-7-13)18(21)22;1-6(2,3)9-5(8)7-4/h4-7,11H,2-3,8-10H2,1H3,(H,16,20);1-4H3,(H,7,8) |
| InChIKey | QJBUSENLQXMCBX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 174.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|