C18H23N3O6S — CID 45492118
methyl 2-[[5-oxo-1-(4-pyrrolidin-1-ylsulfonylphenyl)pyrrolidine-3-carbonyl]amino]acetate (PubChem CID 45492118) has the molecular formula C18H23N3O6S and a molecular weight of 409.46 g/mol. Its IUPAC name is methyl 2-[[5-oxo-1-(4-pyrrolidin-1-ylsulfonylphenyl)pyrrolidine-3-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[5-oxo-1-(4-pyrrolidin-1-ylsulfonylphenyl)pyrrolidine-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 45492118 |
| Molecular Formula | C18H23N3O6S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | methyl 2-[[5-oxo-1-(4-pyrrolidin-1-ylsulfonylphenyl)pyrrolidine-3-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)C1CC(=O)N(c2ccc(S(=O)(=O)N3CCCC3)cc2)C1 |
| InChI | InChI=1S/C18H23N3O6S/c1-27-17(23)11-19-18(24)13-10-16(22)21(12-13)14-4-6-15(7-5-14)28(25,26)20-8-2-3-9-20/h4-7,13H,2-3,8-12H2,1H3,(H,19,24) |
| InChIKey | IDAFZTBVNOCVED-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |