C19H24N4O4S — CID 9402641
(3S)-N-(cyanomethyl)-1-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 9402641) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is (3S)-N-(cyanomethyl)-1-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-(cyanomethyl)-1-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 9402641 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (3S)-N-(cyanomethyl)-1-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(N3C[C@@H](C(=O)NCC#N)CC3=O)cc2)CC1 |
| InChI | InChI=1S/C19H24N4O4S/c1-14-6-10-22(11-7-14)28(26,27)17-4-2-16(3-5-17)23-13-15(12-18(23)24)19(25)21-9-8-20/h2-5,14-15H,6-7,9-13H2,1H3,(H,21,25)/t15-/m0/s1 |
| InChIKey | DIIHHRRGNHSBSK-HNNXBMFYSA-N |
| XLogP | 1.10 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|