C17H23N3O7S — CID 42598678
prop-2-enyl (2S,5S)-2-ethyl-5-(hydroxymethyl)-4-(4-nitrophenyl)sulfonylpiperazine-1-carboxylate (PubChem CID 42598678) has the molecular formula C17H23N3O7S and a molecular weight of 413.45 g/mol. Its IUPAC name is prop-2-enyl (2S,5S)-2-ethyl-5-(hydroxymethyl)-4-(4-nitrophenyl)sulfonylpiperazine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,5S)-2-ethyl-5-(hydroxymethyl)-4-(4-nitrophenyl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 42598678 |
| Molecular Formula | C17H23N3O7S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | prop-2-enyl (2S,5S)-2-ethyl-5-(hydroxymethyl)-4-(4-nitrophenyl)sulfonylpiperazine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](CO)N(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C[C@@H]1CC |
| InChI | InChI=1S/C17H23N3O7S/c1-3-9-27-17(22)18-10-15(12-21)19(11-13(18)4-2)28(25,26)16-7-5-14(6-8-16)20(23)24/h3,5-8,13,15,21H,1,4,9-12H2,2H3/t13-,15-/m0/s1 |
| InChIKey | DKBUZHXEVPEXRV-ZFWWWQNUSA-N |
| XLogP | 1.36 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|