C12H16N2O5S — CID 102786152
[3-methyl-1-(4-nitrophenyl)sulfonylpyrrolidin-2-yl]methanol (PubChem CID 102786152) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is [3-methyl-1-(4-nitrophenyl)sulfonylpyrrolidin-2-yl]methanol.
| Compound Name | [3-methyl-1-(4-nitrophenyl)sulfonylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 102786152 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | [3-methyl-1-(4-nitrophenyl)sulfonylpyrrolidin-2-yl]methanol |
| SMILES | CC1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C1CO |
| InChI | InChI=1S/C12H16N2O5S/c1-9-6-7-13(12(9)8-15)20(18,19)11-4-2-10(3-5-11)14(16)17/h2-5,9,12,15H,6-8H2,1H3 |
| InChIKey | VGIFAFHGCVCJNF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|