C13H18N2O5S — CID 102786144
[3-methyl-1-(2-methyl-5-nitrophenyl)sulfonylpyrrolidin-2-yl]methanol (PubChem CID 102786144) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is [3-methyl-1-(2-methyl-5-nitrophenyl)sulfonylpyrrolidin-2-yl]methanol.
| Compound Name | [3-methyl-1-(2-methyl-5-nitrophenyl)sulfonylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 102786144 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | [3-methyl-1-(2-methyl-5-nitrophenyl)sulfonylpyrrolidin-2-yl]methanol |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCC(C)C1CO |
| InChI | InChI=1S/C13H18N2O5S/c1-9-5-6-14(12(9)8-16)21(19,20)13-7-11(15(17)18)4-3-10(13)2/h3-4,7,9,12,16H,5-6,8H2,1-2H3 |
| InChIKey | SNIATHIGFTYHOI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|