C18H25N3O7S — CID 102422638
prop-2-enyl (2S,5S)-5-(hydroxymethyl)-4-(4-nitrophenyl)sulfonyl-2-propan-2-ylpiperazine-1-carboxylate (PubChem CID 102422638) has the molecular formula C18H25N3O7S and a molecular weight of 427.48 g/mol. Its IUPAC name is prop-2-enyl (2S,5S)-5-(hydroxymethyl)-4-(4-nitrophenyl)sulfonyl-2-propan-2-ylpiperazine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,5S)-5-(hydroxymethyl)-4-(4-nitrophenyl)sulfonyl-2-propan-2-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 102422638 |
| Molecular Formula | C18H25N3O7S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | prop-2-enyl (2S,5S)-5-(hydroxymethyl)-4-(4-nitrophenyl)sulfonyl-2-propan-2-ylpiperazine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](CO)N(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C[C@@H]1C(C)C |
| InChI | InChI=1S/C18H25N3O7S/c1-4-9-28-18(23)19-10-15(12-22)20(11-17(19)13(2)3)29(26,27)16-7-5-14(6-8-16)21(24)25/h4-8,13,15,17,22H,1,9-12H2,2-3H3/t15-,17+/m0/s1 |
| InChIKey | ASSCJZHYLMZBFW-DOTOQJQBSA-N |
| XLogP | 1.61 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|