C21H24BrN3O5S — CID 102213286
[(2R,5S)-2-(bromomethyl)-4-(4-nitrophenyl)sulfonyl-5-propan-2-ylpiperazin-1-yl]-phenylmethanone (PubChem CID 102213286) has the molecular formula C21H24BrN3O5S and a molecular weight of 510.41 g/mol. Its IUPAC name is [(2R,5S)-2-(bromomethyl)-4-(4-nitrophenyl)sulfonyl-5-propan-2-ylpiperazin-1-yl]-phenylmethanone.
| Compound Name | [(2R,5S)-2-(bromomethyl)-4-(4-nitrophenyl)sulfonyl-5-propan-2-ylpiperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 102213286 |
| Molecular Formula | C21H24BrN3O5S |
| Molecular Weight | 510.41 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | [(2R,5S)-2-(bromomethyl)-4-(4-nitrophenyl)sulfonyl-5-propan-2-ylpiperazin-1-yl]-phenylmethanone |
| SMILES | CC(C)[C@H]1CN(C(=O)c2ccccc2)[C@@H](CBr)CN1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H24BrN3O5S/c1-15(2)20-14-23(21(26)16-6-4-3-5-7-16)18(12-22)13-24(20)31(29,30)19-10-8-17(9-11-19)25(27)28/h3-11,15,18,20H,12-14H2,1-2H3/t18-,20+/m0/s1 |
| InChIKey | BOPYRGGRJMHCSX-AZUAARDMSA-N |
| XLogP | 3.53 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|