C22H25N3O5 — CID 178034199
tert-butyl N-[(3R)-7-nitro-2-oxo-1-[(1S)-1-phenylethyl]-3,4-dihydroquinolin-3-yl]carbamate (PubChem CID 178034199) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is tert-butyl N-[(3R)-7-nitro-2-oxo-1-[(1S)-1-phenylethyl]-3,4-dihydroquinolin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-7-nitro-2-oxo-1-[(1S)-1-phenylethyl]-3,4-dihydroquinolin-3-yl]carbamate |
|---|---|
| PubChem CID | 178034199 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | tert-butyl N-[(3R)-7-nitro-2-oxo-1-[(1S)-1-phenylethyl]-3,4-dihydroquinolin-3-yl]carbamate |
| SMILES | C[C@@H](c1ccccc1)N1C(=O)[C@H](NC(=O)OC(C)(C)C)Cc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C22H25N3O5/c1-14(15-8-6-5-7-9-15)24-19-13-17(25(28)29)11-10-16(19)12-18(20(24)26)23-21(27)30-22(2,3)4/h5-11,13-14,18H,12H2,1-4H3,(H,23,27)/t14-,18+/m0/s1 |
| InChIKey | SWKDSTSVLHUVHO-KBXCAEBGSA-N |
| XLogP | 4.14 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|