C18H18FN3O2 — CID 178034082
[(3R)-6-fluoro-2-oxo-1-[(1S)-1-phenylethyl]-3,4-dihydroquinolin-3-yl]urea (PubChem CID 178034082) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is [(3R)-6-fluoro-2-oxo-1-[(1S)-1-phenylethyl]-3,4-dihydroquinolin-3-yl]urea.
| Compound Name | [(3R)-6-fluoro-2-oxo-1-[(1S)-1-phenylethyl]-3,4-dihydroquinolin-3-yl]urea |
|---|---|
| PubChem CID | 178034082 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | [(3R)-6-fluoro-2-oxo-1-[(1S)-1-phenylethyl]-3,4-dihydroquinolin-3-yl]urea |
| SMILES | C[C@@H](c1ccccc1)N1C(=O)[C@H](NC(N)=O)Cc2cc(F)ccc21 |
| InChI | InChI=1S/C18H18FN3O2/c1-11(12-5-3-2-4-6-12)22-16-8-7-14(19)9-13(16)10-15(17(22)23)21-18(20)24/h2-9,11,15H,10H2,1H3,(H3,20,21,24)/t11-,15+/m0/s1 |
| InChIKey | HPUMYTRRRDLULW-XHDPSFHLSA-N |
| XLogP | 2.51 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |