C23H22N2O4 — CID 134961753
3,7-bis[(1R)-1-phenylethyl]-3,7-diazabicyclo[3.3.1]nonane-2,4,6,8-tetrone (PubChem CID 134961753) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 3,7-bis[(1R)-1-phenylethyl]-3,7-diazabicyclo[3.3.1]nonane-2,4,6,8-tetrone.
| Compound Name | 3,7-bis[(1R)-1-phenylethyl]-3,7-diazabicyclo[3.3.1]nonane-2,4,6,8-tetrone |
|---|---|
| PubChem CID | 134961753 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 3,7-bis[(1R)-1-phenylethyl]-3,7-diazabicyclo[3.3.1]nonane-2,4,6,8-tetrone |
| SMILES | C[C@H](c1ccccc1)N1C(=O)C2CC(C1=O)C(=O)N([C@H](C)c1ccccc1)C2=O |
| InChI | InChI=1S/C23H22N2O4/c1-14(16-9-5-3-6-10-16)24-20(26)18-13-19(21(24)27)23(29)25(22(18)28)15(2)17-11-7-4-8-12-17/h3-12,14-15,18-19H,13H2,1-2H3/t14-,15-,18?,19?/m1/s1 |
| InChIKey | QLDRKHPLXXCDQF-QAQJPARQSA-N |
| XLogP | 2.87 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|