C11H11NO3 — CID 3029673
3-(1-phenylethyl)-1,3-oxazolidine-2,4-dione (PubChem CID 3029673) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 3-(1-phenylethyl)-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-(1-phenylethyl)-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 3029673 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3-(1-phenylethyl)-1,3-oxazolidine-2,4-dione |
| SMILES | CC(c1ccccc1)N1C(=O)COC1=O |
| InChI | InChI=1S/C11H11NO3/c1-8(9-5-3-2-4-6-9)12-10(13)7-15-11(12)14/h2-6,8H,7H2,1H3 |
| InChIKey | OBWCRFQZWIKNJM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |