C16H21N2O3+ — CID 7377876
(3S)-3-morpholin-4-ium-4-yl-1-[(1S)-1-phenylethyl]pyrrolidine-2,5-dione (PubChem CID 7377876) has the molecular formula C16H21N2O3+ and a molecular weight of 289.35 g/mol. Its IUPAC name is (3S)-3-morpholin-4-ium-4-yl-1-[(1S)-1-phenylethyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-morpholin-4-ium-4-yl-1-[(1S)-1-phenylethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7377876 |
| Molecular Formula | C16H21N2O3+ |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (3S)-3-morpholin-4-ium-4-yl-1-[(1S)-1-phenylethyl]pyrrolidine-2,5-dione |
| SMILES | C[C@@H](c1ccccc1)N1C(=O)C[C@H]([NH+]2CCOCC2)C1=O |
| InChI | InChI=1S/C16H20N2O3/c1-12(13-5-3-2-4-6-13)18-15(19)11-14(16(18)20)17-7-9-21-10-8-17/h2-6,12,14H,7-11H2,1H3/p+1/t12-,14-/m0/s1 |
| InChIKey | WAAUHEXNMRRHAK-JSGCOSHPSA-O |
| XLogP | -0.21 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|