C20H21NO4 — CID 6636517
(3aR,5aR,9R,9aS,9bS)-9-hydroxy-2-[(1S)-1-phenylethyl]-4,5,5a,9,9a,9b-hexahydro-3aH-benzo[e]isoindole-1,3,6-trione (PubChem CID 6636517) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (3aR,5aR,9R,9aS,9bS)-9-hydroxy-2-[(1S)-1-phenylethyl]-4,5,5a,9,9a,9b-hexahydro-3aH-benzo[e]isoindole-1,3,6-trione.
| Compound Name | (3aR,5aR,9R,9aS,9bS)-9-hydroxy-2-[(1S)-1-phenylethyl]-4,5,5a,9,9a,9b-hexahydro-3aH-benzo[e]isoindole-1,3,6-trione |
|---|---|
| PubChem CID | 6636517 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (3aR,5aR,9R,9aS,9bS)-9-hydroxy-2-[(1S)-1-phenylethyl]-4,5,5a,9,9a,9b-hexahydro-3aH-benzo[e]isoindole-1,3,6-trione |
| SMILES | C[C@@H](c1ccccc1)N1C(=O)[C@H]2[C@H]3[C@H](O)C=CC(=O)[C@@H]3CC[C@H]2C1=O |
| InChI | InChI=1S/C20H21NO4/c1-11(12-5-3-2-4-6-12)21-19(24)14-8-7-13-15(22)9-10-16(23)17(13)18(14)20(21)25/h2-6,9-11,13-14,16-18,23H,7-8H2,1H3/t11-,13-,14+,16+,17+,18+/m0/s1 |
| InChIKey | YPJQUQCYASEHHE-MOYYJVKCSA-N |
| XLogP | 1.87 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|