C20H21NO4 — CID 102245923
(3aR,9bS)-5-methyl-6-[(1S)-1-phenylethyl]-3a,4,8,9,9a,9b-hexahydrofuro[3,4-f]quinoline-1,3,7-trione (PubChem CID 102245923) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (3aR,9bS)-5-methyl-6-[(1S)-1-phenylethyl]-3a,4,8,9,9a,9b-hexahydrofuro[3,4-f]quinoline-1,3,7-trione.
| Compound Name | (3aR,9bS)-5-methyl-6-[(1S)-1-phenylethyl]-3a,4,8,9,9a,9b-hexahydrofuro[3,4-f]quinoline-1,3,7-trione |
|---|---|
| PubChem CID | 102245923 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (3aR,9bS)-5-methyl-6-[(1S)-1-phenylethyl]-3a,4,8,9,9a,9b-hexahydrofuro[3,4-f]quinoline-1,3,7-trione |
| SMILES | CC1=C2C(CCC(=O)N2[C@@H](C)c2ccccc2)[C@@H]2C(=O)OC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C20H21NO4/c1-11-10-15-17(20(24)25-19(15)23)14-8-9-16(22)21(18(11)14)12(2)13-6-4-3-5-7-13/h3-7,12,14-15,17H,8-10H2,1-2H3/t12-,14?,15+,17-/m0/s1 |
| InChIKey | GKFWVWRBUHJZGR-CBXASTFPSA-N |
| XLogP | 2.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|