C17H21NO2 — CID 7188279
(4aR,8aS)-1-[(1R)-1-phenylethyl]-4,4a,5,7,8,8a-hexahydro-3H-quinoline-2,6-dione (PubChem CID 7188279) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (4aR,8aS)-1-[(1R)-1-phenylethyl]-4,4a,5,7,8,8a-hexahydro-3H-quinoline-2,6-dione.
| Compound Name | (4aR,8aS)-1-[(1R)-1-phenylethyl]-4,4a,5,7,8,8a-hexahydro-3H-quinoline-2,6-dione |
|---|---|
| PubChem CID | 7188279 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (4aR,8aS)-1-[(1R)-1-phenylethyl]-4,4a,5,7,8,8a-hexahydro-3H-quinoline-2,6-dione |
| SMILES | C[C@H](c1ccccc1)N1C(=O)CC[C@@H]2CC(=O)CC[C@@H]21 |
| InChI | InChI=1S/C17H21NO2/c1-12(13-5-3-2-4-6-13)18-16-9-8-15(19)11-14(16)7-10-17(18)20/h2-6,12,14,16H,7-11H2,1H3/t12-,14-,16+/m1/s1 |
| InChIKey | VWSJENPSMIMXHA-XPKDYRNWSA-N |
| XLogP | 3.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |