C17H17NO — CID 10538773
(3R,4S)-3-deuterio-4-phenyl-1-[(1R)-1-phenylethyl]azetidin-2-one (PubChem CID 10538773) has the molecular formula C17H17NO and a molecular weight of 252.34 g/mol. Its IUPAC name is (3R,4S)-3-deuterio-4-phenyl-1-[(1R)-1-phenylethyl]azetidin-2-one.
| Compound Name | (3R,4S)-3-deuterio-4-phenyl-1-[(1R)-1-phenylethyl]azetidin-2-one |
|---|---|
| PubChem CID | 10538773 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (3R,4S)-3-deuterio-4-phenyl-1-[(1R)-1-phenylethyl]azetidin-2-one |
| SMILES | [2H][C@H]1C(=O)N([C@H](C)c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H17NO/c1-13(14-8-4-2-5-9-14)18-16(12-17(18)19)15-10-6-3-7-11-15/h2-11,13,16H,12H2,1H3/t13-,16+/m1/s1/i12D/t12-,13-,16+ |
| InChIKey | ABKPBDQKMBOBLP-HZQNGURISA-N |
| XLogP | 3.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |