C35H38N2 — CID 102515555
2,6-diphenyl-3,7-bis[(1S)-1-phenylethyl]-3,7-diazabicyclo[3.3.1]nonane (PubChem CID 102515555) has the molecular formula C35H38N2 and a molecular weight of 486.70 g/mol. Its IUPAC name is 2,6-diphenyl-3,7-bis[(1S)-1-phenylethyl]-3,7-diazabicyclo[3.3.1]nonane.
| Compound Name | 2,6-diphenyl-3,7-bis[(1S)-1-phenylethyl]-3,7-diazabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 102515555 |
| Molecular Formula | C35H38N2 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 2,6-diphenyl-3,7-bis[(1S)-1-phenylethyl]-3,7-diazabicyclo[3.3.1]nonane |
| SMILES | C[C@@H](c1ccccc1)N1CC2CC(CN([C@@H](C)c3ccccc3)C2c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C35H38N2/c1-26(28-15-7-3-8-16-28)36-24-32-23-33(34(36)30-19-11-5-12-20-30)25-37(27(2)29-17-9-4-10-18-29)35(32)31-21-13-6-14-22-31/h3-22,26-27,32-35H,23-25H2,1-2H3/t26-,27-,32?,33?,34?,35?/m0/s1 |
| InChIKey | GGXSSNCEQOTYBM-NEIAVDNYSA-N |
| XLogP | 8.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |