C12H15N — CID 101221832
(2S)-2-ethenyl-1-[(1R)-1-phenylethyl]aziridine (PubChem CID 101221832) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (2S)-2-ethenyl-1-[(1R)-1-phenylethyl]aziridine.
| Compound Name | (2S)-2-ethenyl-1-[(1R)-1-phenylethyl]aziridine |
|---|---|
| PubChem CID | 101221832 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (2S)-2-ethenyl-1-[(1R)-1-phenylethyl]aziridine |
| SMILES | C=C[C@H]1CN1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C12H15N/c1-3-12-9-13(12)10(2)11-7-5-4-6-8-11/h3-8,10,12H,1,9H2,2H3/t10-,12+,13?/m1/s1 |
| InChIKey | OHXMCOMHGPGLDR-FVBASEICSA-N |
| XLogP | 2.62 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|