C17H19NO — CID 134930781
(R)-phenyl-[(2R)-1-[(1R)-1-phenylethyl]aziridin-2-yl]methanol (PubChem CID 134930781) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is (R)-phenyl-[(2R)-1-[(1R)-1-phenylethyl]aziridin-2-yl]methanol.
| Compound Name | (R)-phenyl-[(2R)-1-[(1R)-1-phenylethyl]aziridin-2-yl]methanol |
|---|---|
| PubChem CID | 134930781 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (R)-phenyl-[(2R)-1-[(1R)-1-phenylethyl]aziridin-2-yl]methanol |
| SMILES | C[C@H](c1ccccc1)N1C[C@@H]1[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H19NO/c1-13(14-8-4-2-5-9-14)18-12-16(18)17(19)15-10-6-3-7-11-15/h2-11,13,16-17,19H,12H2,1H3/t13-,16-,17-,18?/m1/s1 |
| InChIKey | DMUOZEYAHQRKCT-CIYNHRHLSA-N |
| XLogP | 3.17 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|