C14H19NO4 — CID 138966686
methyl (2S,3S)-2,3-dihydroxy-3-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]propanoate (PubChem CID 138966686) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl (2S,3S)-2,3-dihydroxy-3-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]propanoate.
| Compound Name | methyl (2S,3S)-2,3-dihydroxy-3-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]propanoate |
|---|---|
| PubChem CID | 138966686 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | methyl (2S,3S)-2,3-dihydroxy-3-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]propanoate |
| SMILES | COC(=O)[C@@H](O)[C@@H](O)[C@@H]1CN1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C14H19NO4/c1-9(10-6-4-3-5-7-10)15-8-11(15)12(16)13(17)14(18)19-2/h3-7,9,11-13,16-17H,8H2,1-2H3/t9-,11+,12+,13+,15?/m1/s1 |
| InChIKey | FIXUSPIYVULKSI-HYLXWZQLSA-N |
| XLogP | 0.33 |
| TPSA | 69.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|