C18H21NO — CID 10515991
(R)-(2-methylphenyl)-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]methanol (PubChem CID 10515991) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is (R)-(2-methylphenyl)-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]methanol.
| Compound Name | (R)-(2-methylphenyl)-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]methanol |
|---|---|
| PubChem CID | 10515991 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (R)-(2-methylphenyl)-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]methanol |
| SMILES | Cc1ccccc1[C@@H](O)[C@@H]1CN1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H21NO/c1-13-8-6-7-11-16(13)18(20)17-12-19(17)14(2)15-9-4-3-5-10-15/h3-11,14,17-18,20H,12H2,1-2H3/t14-,17+,18-,19?/m1/s1 |
| InChIKey | CBJCYELLSLUUHX-HCGGPHHBSA-N |
| XLogP | 3.47 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|