C16H18NO — CID 11984519
CID 11984519 (PubChem CID 11984519) has the molecular formula C16H18NO and a molecular weight of 240.33 g/mol.
| Compound Name | CID 11984519 |
|---|---|
| PubChem CID | 11984519 |
| Molecular Formula | C16H18NO |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | — |
| SMILES | C[C@H](c1ccccc1)N1C[C@@H]1[C@@H](O)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C16H18NO/c1-12(13-7-3-2-4-8-13)17-11-15(17)16(18)14-9-5-6-10-14/h2-10,12,15-16,18H,11H2,1H3/t12-,15-,16+,17?/m1/s1 |
| InChIKey | BYXHTSHMXJTKMA-AJSFGMTHSA-N |
| XLogP | 2.20 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|