C25H28N2 — CID 102508566
(2S,3S)-2-phenyl-N,1-bis[(1S)-1-phenylethyl]azetidin-3-amine (PubChem CID 102508566) has the molecular formula C25H28N2 and a molecular weight of 356.51 g/mol. Its IUPAC name is (2S,3S)-2-phenyl-N,1-bis[(1S)-1-phenylethyl]azetidin-3-amine.
| Compound Name | (2S,3S)-2-phenyl-N,1-bis[(1S)-1-phenylethyl]azetidin-3-amine |
|---|---|
| PubChem CID | 102508566 |
| Molecular Formula | C25H28N2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | (2S,3S)-2-phenyl-N,1-bis[(1S)-1-phenylethyl]azetidin-3-amine |
| SMILES | C[C@H](N[C@H]1CN([C@@H](C)c2ccccc2)[C@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28N2/c1-19(21-12-6-3-7-13-21)26-24-18-27(20(2)22-14-8-4-9-15-22)25(24)23-16-10-5-11-17-23/h3-17,19-20,24-26H,18H2,1-2H3/t19-,20-,24-,25-/m0/s1 |
| InChIKey | NDPIXQMEAQDONR-WNLYKICVSA-N |
| XLogP | 5.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |