C20H21NO — CID 14465638
(4S)-1-[(1S)-1-phenylethyl]-4-[(E)-1-phenylprop-1-en-2-yl]azetidin-2-one (PubChem CID 14465638) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is (4S)-1-[(1S)-1-phenylethyl]-4-[(E)-1-phenylprop-1-en-2-yl]azetidin-2-one.
| Compound Name | (4S)-1-[(1S)-1-phenylethyl]-4-[(E)-1-phenylprop-1-en-2-yl]azetidin-2-one |
|---|---|
| PubChem CID | 14465638 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (4S)-1-[(1S)-1-phenylethyl]-4-[(E)-1-phenylprop-1-en-2-yl]azetidin-2-one |
| SMILES | C/C(=C\c1ccccc1)[C@@H]1CC(=O)N1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C20H21NO/c1-15(13-17-9-5-3-6-10-17)19-14-20(22)21(19)16(2)18-11-7-4-8-12-18/h3-13,16,19H,14H2,1-2H3/b15-13+/t16-,19-/m0/s1 |
| InChIKey | WKRUYCFVJFFGJD-KYPGLKONSA-N |
| XLogP | 4.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |