C16H21NO — CID 132550857
(3aS,7aS)-1-(1-phenylethyl)-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one (PubChem CID 132550857) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is (3aS,7aS)-1-(1-phenylethyl)-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one.
| Compound Name | (3aS,7aS)-1-(1-phenylethyl)-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one |
|---|---|
| PubChem CID | 132550857 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (3aS,7aS)-1-(1-phenylethyl)-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one |
| SMILES | CC(c1ccccc1)N1C(=O)C[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C16H21NO/c1-12(13-7-3-2-4-8-13)17-15-10-6-5-9-14(15)11-16(17)18/h2-4,7-8,12,14-15H,5-6,9-11H2,1H3/t12?,14-,15-/m0/s1 |
| InChIKey | CHHGQARPBBAASL-ZRNAQANOSA-N |
| XLogP | 3.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |