C23H27NO — CID 102237905
(2S,4aS,8aS)-2-phenyl-1-[(1R)-1-phenylethyl]-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one (PubChem CID 102237905) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is (2S,4aS,8aS)-2-phenyl-1-[(1R)-1-phenylethyl]-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one.
| Compound Name | (2S,4aS,8aS)-2-phenyl-1-[(1R)-1-phenylethyl]-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one |
|---|---|
| PubChem CID | 102237905 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (2S,4aS,8aS)-2-phenyl-1-[(1R)-1-phenylethyl]-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one |
| SMILES | C[C@H](c1ccccc1)N1[C@H](c2ccccc2)CC(=O)[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C23H27NO/c1-17(18-10-4-2-5-11-18)24-21-15-9-8-14-20(21)23(25)16-22(24)19-12-6-3-7-13-19/h2-7,10-13,17,20-22H,8-9,14-16H2,1H3/t17-,20+,21+,22+/m1/s1 |
| InChIKey | ONTHBTSNGIWRLG-MNAPGUCWSA-N |
| XLogP | 5.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |